All Downloads are FREE. Search and download functionalities are using the official Maven repository.

com.fasterxml.jackson.databind.JsonNode Maven / Gradle / Ivy

There is a newer version: 198
Show newest version
package com.fasterxml.jackson.databind;

import java.io.IOException;
import java.math.BigDecimal;
import java.math.BigInteger;
import java.util.*;

import com.fasterxml.jackson.core.*;
import com.fasterxml.jackson.databind.node.JsonNodeType;
import com.fasterxml.jackson.databind.node.MissingNode;
import com.fasterxml.jackson.databind.util.EmptyIterator;

/**
 * Base class for all JSON nodes, which form the basis of JSON
 * Tree Model that Jackson implements.
 * One way to think of these nodes is to consider them
 * similar to DOM nodes in XML DOM trees.
 *

* As a general design rule, most accessors ("getters") are included * in this base class, to allow for traversing structure without * type casts. Most mutators, however, need to be accessed through * specific sub-classes (such as ObjectNode * and ArrayNode). * This seems sensible because proper type * information is generally available when building or modifying * trees, but less often when reading a tree (newly built from * parsed JSON content). *

* Actual concrete sub-classes can be found from package * {@link com.fasterxml.jackson.databind.node}. *

* Note that it is possible to "read" from nodes, using * method {@link TreeNode#traverse(ObjectCodec)}, which will result in * a {@link JsonParser} being constructed. This can be used for (relatively) * efficient conversations between different representations; and it is what * core databind uses for methods like {@link ObjectMapper#treeToValue(TreeNode, Class)} * and {@link ObjectMapper#treeAsTokens(TreeNode)} */ public abstract class JsonNode extends JsonSerializable.Base // i.e. implements JsonSerializable implements TreeNode, Iterable { /* /********************************************************** /* Construction, related /********************************************************** */ protected JsonNode() { } /** * Method that can be called to get a node that is guaranteed * not to allow changing of this node through mutators on * this node or any of its children. * This means it can either make a copy of this node (and all * mutable children and grand children nodes), or node itself * if it is immutable. *

* Note: return type is guaranteed to have same type as the * node method is called on; which is why method is declared * with local generic type. * * @since 2.0 * * @return Node that is either a copy of this node (and all non-leaf * children); or, for immutable leaf nodes, node itself. */ public abstract T deepCopy(); /* /********************************************************** /* TreeNode implementation /********************************************************** */ // public abstract JsonToken asToken(); // public abstract JsonToken traverse(); // public abstract JsonToken traverse(ObjectCodec codec); // public abstract JsonParser.NumberType numberType(); @Override public int size() { return 0; } @Override public final boolean isValueNode() { switch (getNodeType()) { case ARRAY: case OBJECT: case MISSING: return false; default: return true; } } @Override public final boolean isContainerNode() { final JsonNodeType type = getNodeType(); return type == JsonNodeType.OBJECT || type == JsonNodeType.ARRAY; } @Override public final boolean isMissingNode() { return getNodeType() == JsonNodeType.MISSING; } @Override public final boolean isArray() { return getNodeType() == JsonNodeType.ARRAY; } @Override public final boolean isObject() { return getNodeType() == JsonNodeType.OBJECT; } /** * Method for accessing value of the specified element of * an array node. For other nodes, null is always returned. *

* For array nodes, index specifies * exact location within array and allows for efficient iteration * over child elements (underlying storage is guaranteed to * be efficiently indexable, i.e. has random-access to elements). * If index is less than 0, or equal-or-greater than * node.size(), null is returned; no exception is * thrown for any index. *

* NOTE: if the element value has been explicitly set as null * (which is different from removal!), * a {@link com.fasterxml.jackson.databind.node.NullNode} will be returned, * not null. * * @return Node that represent value of the specified element, * if this node is an array and has specified element. * Null otherwise. */ @Override public abstract JsonNode get(int index); /** * Method for accessing value of the specified field of * an object node. If this node is not an object (or it * does not have a value for specified field name), or * if there is no field with such name, null is returned. *

* NOTE: if the property value has been explicitly set as null * (which is different from removal!), * a {@link com.fasterxml.jackson.databind.node.NullNode} will be returned, * not null. * * @return Node that represent value of the specified field, * if this node is an object and has value for the specified * field. Null otherwise. */ @Override public JsonNode get(String fieldName) { return null; } /** * This method is similar to {@link #get(String)}, except * that instead of returning null if no such value exists (due * to this node not being an object, or object not having value * for the specified field), * a "missing node" (node that returns true for * {@link #isMissingNode}) will be returned. This allows for * convenient and safe chained access via path calls. */ @Override public abstract JsonNode path(String fieldName); /** * This method is similar to {@link #get(int)}, except * that instead of returning null if no such element exists (due * to index being out of range, or this node not being an array), * a "missing node" (node that returns true for * {@link #isMissingNode}) will be returned. This allows for * convenient and safe chained access via path calls. */ @Override public abstract JsonNode path(int index); @Override public Iterator fieldNames() { return EmptyIterator.instance(); } /** * Method for locating node specified by given JSON pointer instances. * Method will never return null; if no matching node exists, * will return a node for which {@link #isMissingNode()} returns true. * * @return Node that matches given JSON Pointer: if no match exists, * will return a node for which {@link #isMissingNode()} returns true. * * @since 2.3 */ @Override public final JsonNode at(JsonPointer ptr) { // Basically: value nodes only match if we have "empty" path left if (ptr.matches()) { return this; } JsonNode n = _at(ptr); if (n == null) { return MissingNode.getInstance(); } return n.at(ptr.tail()); } /** * Convenience method that is functionally equivalent to: *

     *   return at(JsonPointer.valueOf(jsonPointerExpression));
     *
*

* Note that if the same expression is used often, it is preferable to construct * {@link JsonPointer} instance once and reuse it: this method will not perform * any caching of compiled expressions. * * @param jsonPtrExpr Expression to compile as a {@link JsonPointer} * instance * * @return Node that matches given JSON Pointer: if no match exists, * will return a node for which {@link TreeNode#isMissingNode()} returns true. * * @since 2.3 */ @Override public final JsonNode at(String jsonPtrExpr) { return at(JsonPointer.compile(jsonPtrExpr)); } protected abstract JsonNode _at(JsonPointer ptr); /* /********************************************************** /* Public API, type introspection /********************************************************** */ // // First high-level division between values, containers and "missing" /** * Return the type of this node * * @return the node type as a {@link JsonNodeType} enum value * * @since 2.2 */ public abstract JsonNodeType getNodeType(); /** * Method that can be used to check if the node is a wrapper * for a POJO ("Plain Old Java Object" aka "bean". * Returns true only for * instances of POJONode. * * @return True if this node wraps a POJO */ public final boolean isPojo() { return getNodeType() == JsonNodeType.POJO; } /** * @return True if this node represents a numeric JSON value */ public final boolean isNumber() { return getNodeType() == JsonNodeType.NUMBER; } /** * * @return True if this node represents an integral (integer) * numeric JSON value */ public boolean isIntegralNumber() { return false; } /** * @return True if this node represents a non-integral * numeric JSON value */ public boolean isFloatingPointNumber() { return false; } /** * Method that can be used to check whether contained value * is a number represented as Java short. * Note, however, that even if this method returns false, it * is possible that conversion would be possible from other numeric * types -- to check if this is possible, use * {@link #canConvertToInt()} instead. * * @return True if the value contained by this node is stored as Java short */ public boolean isShort() { return false; } /** * Method that can be used to check whether contained value * is a number represented as Java int. * Note, however, that even if this method returns false, it * is possible that conversion would be possible from other numeric * types -- to check if this is possible, use * {@link #canConvertToInt()} instead. * * @return True if the value contained by this node is stored as Java int */ public boolean isInt() { return false; } /** * Method that can be used to check whether contained value * is a number represented as Java long. * Note, however, that even if this method returns false, it * is possible that conversion would be possible from other numeric * types -- to check if this is possible, use * {@link #canConvertToInt()} instead. * * @return True if the value contained by this node is stored as Java long */ public boolean isLong() { return false; } /** * @since 2.2 */ public boolean isFloat() { return false; } public boolean isDouble() { return false; } public boolean isBigDecimal() { return false; } public boolean isBigInteger() { return false; } /** * Method that checks whether this node represents basic JSON String * value. */ public final boolean isTextual() { return getNodeType() == JsonNodeType.STRING; } /** * Method that can be used to check if this node was created from * JSON boolean value (literals "true" and "false"). */ public final boolean isBoolean() { return getNodeType() == JsonNodeType.BOOLEAN; } /** * Method that can be used to check if this node was created from * JSON literal null value. */ public final boolean isNull() { return getNodeType() == JsonNodeType.NULL; } /** * Method that can be used to check if this node represents * binary data (Base64 encoded). Although this will be externally * written as JSON String value, {@link #isTextual} will * return false if this method returns true. * * @return True if this node represents base64 encoded binary data */ public final boolean isBinary() { return getNodeType() == JsonNodeType.BINARY; } /** * Method that can be used to check whether this node is a numeric * node ({@link #isNumber} would return true) AND its value fits * within Java's 32-bit signed integer type, int. * Note that floating-point numbers are convertible if the integral * part fits without overflow (as per standard Java coercion rules) *

* NOTE: this method does not consider possible value type conversion * from JSON String into Number; so even if this method returns false, * it is possible that {@link #asInt} could still succeed * if node is a JSON String representing integral number, or boolean. * * @since 2.0 */ public boolean canConvertToInt() { return false; } /** * Method that can be used to check whether this node is a numeric * node ({@link #isNumber} would return true) AND its value fits * within Java's 64-bit signed integer type, long. * Note that floating-point numbers are convertible if the integral * part fits without overflow (as per standard Java coercion rules) *

* NOTE: this method does not consider possible value type conversion * from JSON String into Number; so even if this method returns false, * it is possible that {@link #asLong} could still succeed * if node is a JSON String representing integral number, or boolean. * * @since 2.0 */ public boolean canConvertToLong() { return false; } /* /********************************************************** /* Public API, straight value access /********************************************************** */ /** * Method to use for accessing String values. * Does NOT do any conversions for non-String value nodes; * for non-String values (ones for which {@link #isTextual} returns * false) null will be returned. * For String values, null is never returned (but empty Strings may be) * * @return Textual value this node contains, iff it is a textual * JSON node (comes from JSON String value entry) */ public String textValue() { return null; } /** * Method to use for accessing binary content of binary nodes (nodes * for which {@link #isBinary} returns true); or for Text Nodes * (ones for which {@link #textValue} returns non-null value), * to read decoded base64 data. * For other types of nodes, returns null. * * @return Binary data this node contains, iff it is a binary * node; null otherwise */ public byte[] binaryValue() throws IOException { return null; } /** * Method to use for accessing JSON boolean values (value * literals 'true' and 'false'). * For other types, always returns false. * * @return Textual value this node contains, iff it is a textual * json node (comes from JSON String value entry) */ public boolean booleanValue() { return false; } /** * Returns numeric value for this node, if and only if * this node is numeric ({@link #isNumber} returns true); otherwise * returns null * * @return Number value this node contains, if any (null for non-number * nodes). */ public Number numberValue() { return null; } /** * Returns 16-bit short value for this node, if and only if * this node is numeric ({@link #isNumber} returns true). For other * types returns 0. * For floating-point numbers, value is truncated using default * Java coercion, similar to how cast from double to short operates. * * @return Short value this node contains, if any; 0 for non-number * nodes. */ public short shortValue() { return 0; } /** * Returns integer value for this node, if and only if * this node is numeric ({@link #isNumber} returns true). For other * types returns 0. * For floating-point numbers, value is truncated using default * Java coercion, similar to how cast from double to int operates. * * @return Integer value this node contains, if any; 0 for non-number * nodes. */ public int intValue() { return 0; } /** * Returns 64-bit long value for this node, if and only if * this node is numeric ({@link #isNumber} returns true). For other * types returns 0. * For floating-point numbers, value is truncated using default * Java coercion, similar to how cast from double to long operates. * * @return Long value this node contains, if any; 0 for non-number * nodes. */ public long longValue() { return 0L; } /** * Returns 32-bit floating value for this node, if and only if * this node is numeric ({@link #isNumber} returns true). For other * types returns 0.0. * For integer values, conversion is done using coercion; this means * that an overflow is possible for `long` values * * @return 32-bit float value this node contains, if any; 0.0 for non-number nodes. * * @since 2.2 */ public float floatValue() { return 0.0f; } /** * Returns 64-bit floating point (double) value for this node, if and only if * this node is numeric ({@link #isNumber} returns true). For other * types returns 0.0. * For integer values, conversion is done using coercion; this may result * in overflows with {@link BigInteger} values. * * @return 64-bit double value this node contains, if any; 0.0 for non-number nodes. * * @since 2.2 */ public double doubleValue() { return 0.0; } public BigDecimal decimalValue() { return BigDecimal.ZERO; } public BigInteger bigIntegerValue() { return BigInteger.ZERO; } /* /********************************************************** /* Public API, value access with conversion(s)/coercion(s) /********************************************************** */ /** * Method that will return a valid String representation of * the container value, if the node is a value node * (method {@link #isValueNode} returns true), * otherwise empty String. */ public abstract String asText(); /** * Method similar to {@link #asText()}, except that it will return * defaultValue in cases where null value would be returned; * either for missing nodes (trying to access missing property, or element * at invalid item for array) or explicit nulls. * * @since 2.4 */ public String asText(String defaultValue) { String str = asText(); return (str == null) ? defaultValue : str; } /** * Method that will try to convert value of this node to a Java int. * Numbers are coerced using default Java rules; booleans convert to 0 (false) * and 1 (true), and Strings are parsed using default Java language integer * parsing rules. *

* If representation can not be converted to an int (including structured types * like Objects and Arrays), * default value of 0 will be returned; no exceptions are thrown. */ public int asInt() { return asInt(0); } /** * Method that will try to convert value of this node to a Java int. * Numbers are coerced using default Java rules; booleans convert to 0 (false) * and 1 (true), and Strings are parsed using default Java language integer * parsing rules. *

* If representation can not be converted to an int (including structured types * like Objects and Arrays), * specified defaultValue will be returned; no exceptions are thrown. */ public int asInt(int defaultValue) { return defaultValue; } /** * Method that will try to convert value of this node to a Java long. * Numbers are coerced using default Java rules; booleans convert to 0 (false) * and 1 (true), and Strings are parsed using default Java language integer * parsing rules. *

* If representation can not be converted to an long (including structured types * like Objects and Arrays), * default value of 0 will be returned; no exceptions are thrown. */ public long asLong() { return asLong(0L); } /** * Method that will try to convert value of this node to a Java long. * Numbers are coerced using default Java rules; booleans convert to 0 (false) * and 1 (true), and Strings are parsed using default Java language integer * parsing rules. *

* If representation can not be converted to an long (including structured types * like Objects and Arrays), * specified defaultValue will be returned; no exceptions are thrown. */ public long asLong(long defaultValue) { return defaultValue; } /** * Method that will try to convert value of this node to a Java double. * Numbers are coerced using default Java rules; booleans convert to 0.0 (false) * and 1.0 (true), and Strings are parsed using default Java language integer * parsing rules. *

* If representation can not be converted to an int (including structured types * like Objects and Arrays), * default value of 0.0 will be returned; no exceptions are thrown. */ public double asDouble() { return asDouble(0.0); } /** * Method that will try to convert value of this node to a Java double. * Numbers are coerced using default Java rules; booleans convert to 0.0 (false) * and 1.0 (true), and Strings are parsed using default Java language integer * parsing rules. *

* If representation can not be converted to an int (including structured types * like Objects and Arrays), * specified defaultValue will be returned; no exceptions are thrown. */ public double asDouble(double defaultValue) { return defaultValue; } /** * Method that will try to convert value of this node to a Java boolean. * JSON booleans map naturally; integer numbers other than 0 map to true, and * 0 maps to false * and Strings 'true' and 'false' map to corresponding values. *

* If representation can not be converted to a boolean value (including structured types * like Objects and Arrays), * default value of false will be returned; no exceptions are thrown. */ public boolean asBoolean() { return asBoolean(false); } /** * Method that will try to convert value of this node to a Java boolean. * JSON booleans map naturally; integer numbers other than 0 map to true, and * 0 maps to false * and Strings 'true' and 'false' map to corresponding values. *

* If representation can not be converted to a boolean value (including structured types * like Objects and Arrays), * specified defaultValue will be returned; no exceptions are thrown. */ public boolean asBoolean(boolean defaultValue) { return defaultValue; } /* /********************************************************** /* Public API, value find / existence check methods /********************************************************** */ /** * Method that allows checking whether this node is JSON Object node * and contains value for specified property. If this is the case * (including properties with explicit null values), returns true; * otherwise returns false. *

* This method is equivalent to: *

     *   node.get(fieldName) != null
     *
* (since return value of get() is node, not value node contains) *

* NOTE: when explicit null values are added, this * method will return true for such properties. * * @param fieldName Name of element to check * * @return True if this node is a JSON Object node, and has a property * entry with specified name (with any value, including null value) */ public boolean has(String fieldName) { return get(fieldName) != null; } /** * Method that allows checking whether this node is JSON Array node * and contains a value for specified index * If this is the case * (including case of specified indexing having null as value), returns true; * otherwise returns false. *

* Note: array element indexes are 0-based. *

* This method is equivalent to: *

     *   node.get(index) != null
     *
*

* NOTE: this method will return true for explicitly added * null values. * * @param index Index to check * * @return True if this node is a JSON Object node, and has a property * entry with specified name (with any value, including null value) */ public boolean has(int index) { return get(index) != null; } /** * Method that is similar to {@link #has(String)}, but that will * return false for explicitly added nulls. *

* This method is functionally equivalent to: *

     *   node.get(fieldName) != null << !node.get(fieldName).isNull()
     *
* * @since 2.1 */ public boolean hasNonNull(String fieldName) { JsonNode n = get(fieldName); return (n != null) && !n.isNull(); } /** * Method that is similar to {@link #has(int)}, but that will * return false for explicitly added nulls. *

* This method is equivalent to: *

     *   node.get(index) != null << !node.get(index).isNull()
     *
* * @since 2.1 */ public boolean hasNonNull(int index) { JsonNode n = get(index); return (n != null) && !n.isNull(); } /* /********************************************************** /* Public API, container access /********************************************************** */ /** * Same as calling {@link #elements}; implemented so that * convenience "for-each" loop can be used for looping over elements * of JSON Array constructs. */ @Override public final Iterator iterator() { return elements(); } /** * Method for accessing all value nodes of this Node, iff * this node is a JSON Array or Object node. In case of Object node, * field names (keys) are not included, only values. * For other types of nodes, returns empty iterator. */ public Iterator elements() { return EmptyIterator.instance(); } /** * @return Iterator that can be used to traverse all key/value pairs for * object nodes; empty iterator (no contents) for other types */ public Iterator> fields() { return EmptyIterator.instance(); } /* /********************************************************** /* Public API, find methods /********************************************************** */ /** * Method for finding a JSON Object field with specified name in this * node or its child nodes, and returning value it has. * If no matching field is found in this node or its descendants, returns null. * * @param fieldName Name of field to look for * * @return Value of first matching node found, if any; null if none */ public abstract JsonNode findValue(String fieldName); /** * Method for finding JSON Object fields with specified name, and returning * found ones as a List. Note that sub-tree search ends if a field is found, * so possible children of result nodes are not included. * If no matching fields are found in this node or its descendants, returns * an empty List. * * @param fieldName Name of field to look for */ public final List findValues(String fieldName) { List result = findValues(fieldName, null); if (result == null) { return Collections.emptyList(); } return result; } /** * Similar to {@link #findValues}, but will additionally convert * values into Strings, calling {@link #asText}. */ public final List findValuesAsText(String fieldName) { List result = findValuesAsText(fieldName, null); if (result == null) { return Collections.emptyList(); } return result; } /** * Method similar to {@link #findValue}, but that will return a * "missing node" instead of null if no field is found. Missing node * is a specific kind of node for which {@link #isMissingNode} * returns true; and all value access methods return empty or * missing value. * * @param fieldName Name of field to look for * * @return Value of first matching node found; or if not found, a * "missing node" (non-null instance that has no value) */ public abstract JsonNode findPath(String fieldName); /** * Method for finding a JSON Object that contains specified field, * within this node or its descendants. * If no matching field is found in this node or its descendants, returns null. * * @param fieldName Name of field to look for * * @return Value of first matching node found, if any; null if none */ public abstract JsonNode findParent(String fieldName); /** * Method for finding a JSON Object that contains specified field, * within this node or its descendants. * If no matching field is found in this node or its descendants, returns null. * * @param fieldName Name of field to look for * * @return Value of first matching node found, if any; null if none */ public final List findParents(String fieldName) { List result = findParents(fieldName, null); if (result == null) { return Collections.emptyList(); } return result; } public abstract List findValues(String fieldName, List foundSoFar); public abstract List findValuesAsText(String fieldName, List foundSoFar); public abstract List findParents(String fieldName, List foundSoFar); /* /********************************************************** /* Public API, path handling /********************************************************** */ /** * Method that can be called on Object nodes, to access a property * that has Object value; or if no such property exists, to create, * add and return such Object node. * If the node method is called on is not Object node, * or if property exists and has value that is not Object node, * {@link UnsupportedOperationException} is thrown */ public JsonNode with(String propertyName) { throw new UnsupportedOperationException("JsonNode not of type ObjectNode (but " +getClass().getName()+"), can not call with() on it"); } /** * Method that can be called on Object nodes, to access a property * that has Array value; or if no such property exists, to create, * add and return such Array node. * If the node method is called on is not Object node, * or if property exists and has value that is not Array node, * {@link UnsupportedOperationException} is thrown */ public JsonNode withArray(String propertyName) { throw new UnsupportedOperationException("JsonNode not of type ObjectNode (but " +getClass().getName()+"), can not call withArray() on it"); } /* /********************************************************** /* Public API, comparison /********************************************************** */ /** * Entry method for invoking customizable comparison, using passed-in * {@link Comparator} object. Nodes will handle traversal of structured * types (arrays, objects), but defer to comparator for scalar value * comparisons. If a "natural" {@link Comparator} is passed -- one that * simply calls equals() on one of arguments, passing the other * -- implementation is the same as directly calling equals() * on node. *

* Default implementation simply delegates to passed in comparator, * with this as the first argument, and other as * the second argument. * * @param comparator Object called to compare two scalar {@link JsonNode} * instances, and return either 0 (are equals) or non-zero (not equal) * * @since 2.6 */ public boolean equals(Comparator comparator, JsonNode other) { return comparator.compare(this, other) == 0; } /* /********************************************************** /* Overridden standard methods /********************************************************** */ /** *

* Note: marked as abstract to ensure all implementation * classes define it properly. */ @Override public abstract String toString(); /** * Equality for node objects is defined as full (deep) value * equality. This means that it is possible to compare complete * JSON trees for equality by comparing equality of root nodes. *

* Note: marked as abstract to ensure all implementation * classes define it properly and not rely on definition * from {@link java.lang.Object}. */ @Override public abstract boolean equals(Object o); }





© 2015 - 2024 Weber Informatics LLC | Privacy Policy