iaik.pkcs.pkcs11.Session Maven / Gradle / Ivy
Go to download
Show more of this group Show more artifacts with this name
Show all versions of sunpkcs11-wrapper Show documentation
Show all versions of sunpkcs11-wrapper Show documentation
PKCS#11 wrapper based on sunpkcs11
// Copyright (c) 2002 Graz University of Technology. All rights reserved.
//
// Redistribution and use in source and binary forms, with or without
// modification, are permitted provided that the following conditions are met:
//
// 1. Redistributions of source code must retain the above copyright notice,
// this list of conditions and the following disclaimer.
//
// 2. Redistributions in binary form must reproduce the above copyright notice,
// this list of conditions and the following disclaimer in the documentation
// and/or other materials provided with the distribution.
//
// 3. The end-user documentation included with the redistribution, if any, must
// include the following acknowledgment:
//
// "This product includes software developed by IAIK of Graz University of
// Technology."
//
// Alternately, this acknowledgment may appear in the software itself, if and
// wherever such third-party acknowledgments normally appear.
//
// 4. The names "Graz University of Technology" and "IAIK of Graz University of
// Technology" must not be used to endorse or promote products derived from
// this software without prior written permission.
//
// 5. Products derived from this software may not be called "IAIK PKCS Wrapper",
// nor may "IAIK" appear in their name, without prior written permission of
// Graz University of Technology.
//
// THIS SOFTWARE IS PROVIDED "AS IS" AND ANY EXPRESSED OR IMPLIED
// WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
// WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
// PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE LICENSOR BE
// LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY,
// OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
// PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA,
// OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON
// ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
// OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY
// OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
// POSSIBILITY OF SUCH DAMAGE.
package iaik.pkcs.pkcs11;
import java.lang.reflect.Constructor;
import java.lang.reflect.Field;
import java.lang.reflect.InvocationTargetException;
import java.lang.reflect.Method;
import java.util.Vector;
import iaik.pkcs.pkcs11.objects.Key;
import iaik.pkcs.pkcs11.objects.KeyPair;
import iaik.pkcs.pkcs11.objects.PKCS11Object;
import iaik.pkcs.pkcs11.objects.PrivateKey;
import iaik.pkcs.pkcs11.objects.PublicKey;
import iaik.pkcs.pkcs11.objects.SecretKey;
import iaik.pkcs.pkcs11.parameters.AesCtrParameters;
import iaik.pkcs.pkcs11.parameters.CCMParameters;
import iaik.pkcs.pkcs11.parameters.DHPkcsDeriveParameters;
import iaik.pkcs.pkcs11.parameters.EcDH1KeyDerivationParameters;
import iaik.pkcs.pkcs11.parameters.EcDH2KeyDerivationParameters;
import iaik.pkcs.pkcs11.parameters.ExtractParameters;
import iaik.pkcs.pkcs11.parameters.GCMParameters;
import iaik.pkcs.pkcs11.parameters.InitializationVectorParameters;
import iaik.pkcs.pkcs11.parameters.MacGeneralParameters;
import iaik.pkcs.pkcs11.parameters.ObjectHandleParameters;
import iaik.pkcs.pkcs11.parameters.OpaqueParameters;
import iaik.pkcs.pkcs11.parameters.PBEParameters;
import iaik.pkcs.pkcs11.parameters.PKCS5PBKD2Parameters;
import iaik.pkcs.pkcs11.parameters.Parameters;
import iaik.pkcs.pkcs11.parameters.RSAPkcsOaepParameters;
import iaik.pkcs.pkcs11.parameters.RSAPkcsPssParameters;
import iaik.pkcs.pkcs11.parameters.SSL3KeyMaterialParameters;
import iaik.pkcs.pkcs11.parameters.SSL3MasterKeyDeriveParameters;
import iaik.pkcs.pkcs11.parameters.SSL3RandomDataParameters;
import iaik.pkcs.pkcs11.parameters.TLS12KeyMaterialParameters;
import iaik.pkcs.pkcs11.parameters.TLS12MasterKeyDeriveParameters;
import iaik.pkcs.pkcs11.parameters.TLSMacParameters;
import iaik.pkcs.pkcs11.parameters.TLSPRFParameters;
import iaik.pkcs.pkcs11.parameters.VersionParameters;
import iaik.pkcs.pkcs11.parameters.X942DH1KeyDerivationParameters;
import iaik.pkcs.pkcs11.parameters.X942DH2KeyDerivationParameters;
import iaik.pkcs.pkcs11.wrapper.PKCS11Constants;
import iaik.pkcs.pkcs11.wrapper.PKCS11Exception;
import sun.security.pkcs11.wrapper.CK_ATTRIBUTE;
import sun.security.pkcs11.wrapper.CK_MECHANISM;
import sun.security.pkcs11.wrapper.CK_RSA_PKCS_PSS_PARAMS;
import sun.security.pkcs11.wrapper.CK_SESSION_INFO;
import sun.security.pkcs11.wrapper.CK_SSL3_KEY_MAT_OUT;
import sun.security.pkcs11.wrapper.CK_SSL3_KEY_MAT_PARAMS;
import sun.security.pkcs11.wrapper.CK_SSL3_MASTER_KEY_DERIVE_PARAMS;
import sun.security.pkcs11.wrapper.CK_VERSION;
import sun.security.pkcs11.wrapper.PKCS11;
/**
* Session objects are used to perform cryptographic operations on a token. The
* application gets a Session object by calling openSession on a certain Token
* object. Having the session object, the application may log-in the user, if
* required.
*
*
*
* TokenInfo tokenInfo = token.getTokenInfo();
* // check, if log-in of the user is required at all
* if (tokenInfo.isLoginRequired()) {
* // check, if the token has own means to authenticate the user; e.g. a
* // PIN-pad on the reader
* if (tokenInfo.isProtectedAuthenticationPath()) {
* System.out.println(
* "Please enter the user PIN at the PIN-pad of your reader.");
* // the token prompts the PIN by other means; e.g. PIN-pad
* session.login(Session.UserType.USER, null);
* } else {
* System.out.print("Enter user-PIN and press [return key]: ");
* System.out.flush();
* BufferedReader input = new BufferedReader(
* new InputStreamReader(System.in));
* String userPINString = input.readLine();
* session.login(Session.UserType.USER, userPINString.toCharArray());
* }
* }
*
*
* With this session object the application can search for token objects and
* perform a cryptographic operation. For example, to find private RSA keys that
* the application can use for signing, you can write:
*
*
*
* RSAPrivateKey privateSignatureKeyTemplate = new RSAPrivateKey();
* privateSignatureKeyTemplate.getSign().setBooleanValue(Boolean.TRUE);
*
* session.findObjectsInit(privateSignatureKeyTemplate);
* PKCS11Object[] privateSignatureKeys;
*
* List signatureKeyList = new Vector(4);
* while ((privateSignatureKeys = session.findObjects(1)).length > 0) {
* signatureKeyList.add(privateSignatureKeys[0]);
* }
* session.findObjectsFinal();
*
*
* Having chosen one of this keys, the application can create a signature value
* using it.
*
*
*
* // e.g. the encoded digest info object that contains an identifier of the
* // hash algorithm and the hash value
* byte[] toBeSigned;
*
* // toBeSigned = ... assign value
*
* RSAPrivateKey selectedSignatureKey;
*
* // selectedSignatureKey = ... assign one of the available signature keys
*
* // initialize for signing
* session.signInit(Mechanism.RSA_PKCS, selectedSignatureKey);
*
* // sign the data to be signed
* byte[] signatureValue = session.sign(toBeSigned);
*
*
* If the application does not need the session any longer, it should close the
* session.
*
*
*
* session.closeSession();
*
*
*
* @see iaik.pkcs.pkcs11.objects.PKCS11Object
* @see iaik.pkcs.pkcs11.parameters.Parameters
* @see iaik.pkcs.pkcs11.Session
* @see iaik.pkcs.pkcs11.SessionInfo
* @author Karl Scheibelhofer
* @version 1.0
*/
public class Session {
/**
* This interface defines the different user types of PKCS#11.
*
* @author Karl Scheibelhofer
* @version 1.0
*/
public interface UserType {
/**
* This constant stands for the security officer.
*/
public static boolean SO = false;
/**
* Thsi constant stands for the user (token owner).
*/
public static boolean USER = true;
}
private static final Method encrypt0;
private static final Method encrypt1;
private static final Method decrypt0;
private static final Method decrypt1;
private static final Field field_CK_MECHANISM_pParameter;
private static final Method method_CK_MECHANISM_setParameter;
private static final Constructor constructor_CK_MECHANISM_CCM;
private static final Constructor constructor_CK_MECHANISM_GCM;
private static final Constructor constructor_CK_MECHANISM_TLS12KeyMat;
private static final Constructor
constructor_CK_MECHANISM_TLS12MasterKeyDerive;
private static final Constructor constructor_CK_MECHANISM_TLSMac;
/**
* A reference to the underlying PKCS#11 module to perform the operations.
*/
private Module module;
/**
* A reference to the underlying PKCS#11 module to perform the operations.
*/
private PKCS11 pkcs11Module;
/**
* The session handle to perform the operations with.
*/
private long sessionHandle;
/**
* The token to perform the operations on.
*/
private Token token;
static {
Class clazz = PKCS11.class;
decrypt0 = Util.getMethod(clazz, "C_Decrypt",
long.class, byte[].class, int.class, int.class,
byte[].class, int.class, int.class);
encrypt0 = Util.getMethod(clazz, "C_Encrypt",
long.class, byte[].class, int.class, int.class,
byte[].class, int.class, int.class);
if (decrypt0 == null) {
decrypt1 = Util.getMethod(clazz, "C_Decrypt",
long.class, long.class, byte[].class, int.class, int.class,
long.class, byte[].class, int.class, int.class);
} else {
decrypt1 = null;
}
if (encrypt0 == null) {
encrypt1 = Util.getMethod(clazz, "C_Encrypt",
long.class, long.class, byte[].class, int.class, int.class,
long.class, byte[].class, int.class, int.class);
} else {
encrypt1 = null;
}
clazz = CK_MECHANISM.class;
field_CK_MECHANISM_pParameter = Util.getField(clazz, "pParameter");
method_CK_MECHANISM_setParameter = Util.getMethod(clazz, "setParameter",
CK_RSA_PKCS_PSS_PARAMS.class);
constructor_CK_MECHANISM_CCM =
getConstructofOfCK_MECHANISM(CCMParameters.CLASS_CK_PARAMS);
constructor_CK_MECHANISM_GCM =
getConstructofOfCK_MECHANISM(GCMParameters.CLASS_CK_PARAMS);
constructor_CK_MECHANISM_TLS12KeyMat =
getConstructofOfCK_MECHANISM(
TLS12KeyMaterialParameters.CLASS_CK_PARAMS);
constructor_CK_MECHANISM_TLS12MasterKeyDerive =
getConstructofOfCK_MECHANISM(
TLS12MasterKeyDeriveParameters.CLASS_CK_PARAMS);
constructor_CK_MECHANISM_TLSMac =
getConstructofOfCK_MECHANISM(TLSMacParameters.CLASS_CK_PARAMS);
}
private static Constructor getConstructofOfCK_MECHANISM(
String paramsClassName) {
Class paramsClass;
try {
paramsClass = Class.forName(paramsClassName);
} catch (ClassNotFoundException ex) {
return null;
}
return Util.getConstructor(CK_MECHANISM.class, long.class, paramsClass);
}
/**
* Constructor taking the token and the session handle.
*
* @param token
* The token this session operates with.
* @param sessionHandle
* The session handle to perform the operations with.
*/
protected Session(Token token, long sessionHandle) {
this.token = Util.requireNonNull("token", token);
this.module = token.getSlot().getModule();
this.pkcs11Module = module.getPKCS11Module();
this.sessionHandle = sessionHandle;
}
/**
* Initializes the user-PIN. Can only be called from a read-write security
* officer session. May be used to set a new user-PIN if the user-PIN is
* locked.
*
* @param pin
* The new user-PIN. This parameter may be null, if the token has
* a protected authentication path. Refer to the PKCS#11 standard
* for details.
* @exception TokenException
* If the session has not the right to set the PIN of if the
* operation fails for some other reason.
*/
/*
public void initPIN(char[] pin)
throws TokenException {
pkcs11Module.C_InitPIN(sessionHandle, pin, useUtf8Encoding);
}*/
/**
* Set the user-PIN to a new value. Can only be called from a read-write
* sessions.
*
* @param oldPin
* The old (current) user-PIN.
* @param newPin
* The new value for the user-PIN.
* @exception TokenException
* If setting the new PIN fails.
*/
/*
public void setPIN(char[] oldPin, char[] newPin)
throws TokenException {
pkcs11Module.C_SetPIN(sessionHandle, oldPin, newPin,
useUtf8Encoding);
}*/
/**
* Closes this session.
*
* @exception TokenException
* If closing the session failed.
*/
public void closeSession() throws TokenException {
try {
pkcs11Module.C_CloseSession(sessionHandle);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Compares the sessionHandle and token of this object with the other
* object. Returns only true, if those are equal in both objects.
*
* @param otherObject
* The other Session object.
* @return True, if other is an instance of Token and the session handles
* and tokens of both objects are equal. False, otherwise.
*/
@Override
public boolean equals(Object otherObject) {
if (this == otherObject) {
return true;
} else if (!(otherObject instanceof Session)) {
return false;
}
Session other = (Session) otherObject;
if (this.sessionHandle != other.sessionHandle) {
return false;
}
return this.token.equals(other.token);
}
/**
* The overriding of this method should ensure that the objects of this
* class work correctly in a hashtable.
*
* @return The hash code of this object. Gained from the sessionHandle.
*/
@Override
public int hashCode() {
return (int) sessionHandle;
}
/**
* Get the handle of this session.
*
* @return The handle of this session.
*/
public long getSessionHandle() {
return sessionHandle;
}
/**
* Get information about this session.
*
* @return An object providing information about this session.
* @exception TokenException
* If getting the information failed.
*/
public SessionInfo getSessionInfo() throws TokenException {
CK_SESSION_INFO ckSessionInfo;
try {
ckSessionInfo = pkcs11Module.C_GetSessionInfo(sessionHandle);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
return new SessionInfo(ckSessionInfo);
}
/**
* Get the Module which this Session object operates with.
*
* @return The module of this session.
*/
public Module getModule() {
return module;
}
/**
* Get the token that created this Session object.
*
* @return The token of this session.
*/
public Token getToken() {
return token;
}
/**
* Get the current operation state. This state can be used later to restore
* the operation to exactly this state.
*
* @return The current operation state as a byte array.
* @exception TokenException
* If saving the state fails or is not possible.
* @see #setOperationState(byte[],Key,Key)
*/
public byte[] getOperationState() throws TokenException {
try {
return pkcs11Module.C_GetOperationState(sessionHandle);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Sets the operation state of this session to a previously saved one. This
* method may need the key used during the saved operation to continue,
* because it may not be possible to save a key into the state's byte array.
* Refer to the PKCS#11 standard for details on this function.
*
* @param operationState
* The previously saved state as returned by getOperationState().
* @param encryptionKey
* A encryption or decryption key, if a encryption or decryption
* operation was saved which should be continued, but the keys
* could not be saved.
* @param authenticationKey
* A signing, verification of MAC key, if a signing, verification
* or MAC operation needs to be restored that could not save the
* key.
* @exception TokenException
* If restoring the state fails.
* @see #getOperationState()
*/
public void setOperationState(byte[] operationState, Key encryptionKey,
Key authenticationKey) throws TokenException {
try {
pkcs11Module.C_SetOperationState(sessionHandle, operationState,
encryptionKey.getObjectHandle(), authenticationKey.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
public void setSessionHandle(long sessionHandle) {
this.sessionHandle = sessionHandle;
}
/**
* Logs in the user or the security officer to the session. Notice that all
* sessions of a token have the same login state; i.e. if you login the user
* to one session all other open sessions of this token get user rights.
*
* @param userType
* UserType.SO for the security officer or UserType.USER to login
* the user.
* @param pin
* The PIN. The security officer-PIN or the user-PIN depending on
* the userType parameter.
* @exception TokenException
* If login fails.
*/
public void login(boolean userType, char[] pin) throws TokenException {
long tmpUserType = (userType == UserType.SO)
? PKCS11Constants.CKU_SO : PKCS11Constants.CKU_USER;
try {
pkcs11Module.C_Login(sessionHandle, tmpUserType, pin);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Logs in the user or the security officer to the session. Notice that all
* sessions of a token have the same login state; i.e. if you login the user
* to one session all other open sessions of this token get user rights.
*
* @param userType
* PKCS11Constants.CKU_SO for the security officer or
* PKCS11Constants.CKU_USER to login the user.
* @param pin
* The PIN. The security officer-PIN or the user-PIN depending on
* the userType parameter.
* @exception TokenException
* If login fails.
*/
public void login(long userType, char[] pin) throws TokenException {
try {
pkcs11Module.C_Login(sessionHandle, userType, pin);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Logs out this session.
*
* @exception TokenException
* If logging out the session fails.
*/
public void logout() throws TokenException {
try {
pkcs11Module.C_Logout(sessionHandle);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Create a new object on the token (or in the session). The application
* must provide a template that holds enough information to create a certain
* object. For instance, if the application wants to create a new DES key
* object it creates a new instance of the DESSecretKey class to serve as a
* template. The application must set all attributes of this new object
* which are required for the creation of such an object on the token. Then
* it passes this DESSecretKey object to this method to create the object on
* the token. Example:
*
* ValuedSecretKey aesKeyTemplate =
* new ValuedSecretKey(PKCS11Constants.CKK_AES);
* aesKeyTemplate.setValue(myDesKeyValueAs8BytesLongByteArray);
* aesKeyTemplate.setToken(Boolean.TRUE);
* aesKeyTemplate.setPrivate(Boolean.TRUE);
* aesKeyTemplate.setEncrypt(Boolean.TRUE);
* aesKeyTemplate.setDecrypt(Boolean.TRUE);
* ...
* ValuedSecretKey theCreatedAESKeyObject =
* (ValuedSecretKey) userSession.createObject(aesKeyTemplate);
*
*
* Refer to the PKCS#11 standard to find out what attributes must be
* set for certain types of objects to create them on the token.
*
* @param templateObject
* The template object that holds all values that the new object on
* the token should contain. (this is not a Object!)
* @return A new PKCS#11 PKCS11Object (this is not a Object!) that
* serves holds all the (readable) attributes of the object on the
* token. In contrast to the templateObject, this object might have
* certain attributes set to token-dependent default-values.
* @exception TokenException
* If the creation of the new object fails. If it fails, the no
* new object was created on the token.
*/
public PKCS11Object createObject(PKCS11Object templateObject)
throws TokenException {
CK_ATTRIBUTE[] ckAttributes = PKCS11Object.getSetAttributes(templateObject);
long objectHandle;
try {
objectHandle = pkcs11Module.C_CreateObject(sessionHandle, ckAttributes);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
return PKCS11Object.getInstance(this, objectHandle);
}
/**
* Copy an existing object. The source object and a template object are
* given. Any value set in the template object will override the
* corresponding value from the source object, when the new object is
* created. See the PKCS#11 standard for details.
*
* @param sourceObject
* The source object of the copy operation.
* @param templateObject
* A template object which's attribute values are used for the new
* object; i.e. they have higher priority than the attribute values
* from the source object. May be null; in that case the new object
* is just a one-to-one copy of the sourceObject.
* @return The new object that is created by copying the source object and
* setting attributes to the values given by the templateObject.
* @exception TokenException
* If copying the object fails for some reason.
*/
public PKCS11Object copyObject(PKCS11Object sourceObject,
PKCS11Object templateObject) throws TokenException {
long sourceObjectHandle = sourceObject.getObjectHandle();
CK_ATTRIBUTE[] ckAttributes = PKCS11Object.getSetAttributes(templateObject);
long newObjectHandle;
try {
newObjectHandle = pkcs11Module.C_CopyObject(sessionHandle,
sourceObjectHandle, ckAttributes);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
return PKCS11Object.getInstance(this, newObjectHandle);
}
/**
* Gets all present attributes of the given template object an writes them
* to the object to update on the token (or in the session). Both parameters
* may refer to the same Java object. This is possible, because this method
* only needs the object handle of the objectToUpdate, and gets the
* attributes to set from the template. This means, an application can get
* the object using createObject of findObject, then modify attributes of
* this Java object and then call this method passing this object as both
* parameters. This will update the object on the token to the values as
* modified in the Java object.
*
* @param objectToUpdate
* The attributes of this object get updated.
* @param templateObject
* This methods gets all present attributes of this template object
* and set this attributes at the objectToUpdate.
* @exception TokenException
* If update of the attributes fails. All or no attributes are
* updated.
*/
public void setAttributeValues(PKCS11Object objectToUpdate,
PKCS11Object templateObject) throws TokenException {
long objectToUpdateHandle = objectToUpdate.getObjectHandle();
CK_ATTRIBUTE[] ckAttributesTemplates =
PKCS11Object.getSetAttributes(templateObject);
try {
pkcs11Module.C_SetAttributeValue(sessionHandle,
objectToUpdateHandle, ckAttributesTemplates);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Reads all the attributes of the given PKCS11Object from the token and
* returns a new PKCS11Object that contains all these attributes. The
* given objectToRead and the returned PKCS11Object are different Java
* objects. This method just uses the object handle of the given object,
* it does not modify anything in this object.
*
* @param objectToRead
* The object to newly read from the token.
* @return A new PKCS11Object holding all attributes that this method just
* read from the token.
* @exception TokenException
* If reading the attributes fails.
*/
public PKCS11Object getAttributeValues(PKCS11Object objectToRead)
throws TokenException {
long objectHandle = objectToRead.getObjectHandle();
return PKCS11Object.getInstance(this, objectHandle);
}
/**
* Destroy a certain object on the token (or in the session). Give the
* object that you want to destroy. This method uses only the internal
* object handle of the given object to identify the object.
*
* @param object
* The object that should be destroyed.
* @exception TokenException
* If the object could not be destroyed.
*/
public void destroyObject(PKCS11Object object) throws TokenException {
long objectHandle = object.getObjectHandle();
try {
pkcs11Module.C_DestroyObject(sessionHandle, objectHandle);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Get the size of the specified object in bytes. This size specifies how
* much memory the object takes up on the token.
*
* @param object
* The object to get the size for.
* @return The object's size bytes.
* @exception TokenException
* If determining the size fails.
*/
/*
public long getObjectSize(PKCS11Object object)
throws TokenException {
long objectHandle = object.getObjectHandle();
return pkcs11Module.C_GetObjectSize(sessionHandle, objectHandle);
}*/
/**
* Initializes a find operations that provides means to find objects by
* passing a template object. This method gets all set attributes of the
* template object and searches for all objects on the token that match with
* these attributes.
*
* @param templateObject
* The object that serves as a template for searching. If this
* object is null, the find operation will find all objects that
* this session can see. Notice, that only a user session will see
* private objects.
* @exception TokenException
* If initializing the find operation fails.
*/
public void findObjectsInit(PKCS11Object templateObject)
throws TokenException {
CK_ATTRIBUTE[] ckAttributes = PKCS11Object.getSetAttributes(templateObject);
try {
pkcs11Module.C_FindObjectsInit(sessionHandle, ckAttributes);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Finds objects that match the template object passed to findObjectsInit.
* The application must call findObjectsInit before calling this method.
* With maxObjectCount the application can specify how many objects to
* return at once; i.e. the application can get all found objects by
* subsequent calls to this method like maxObjectCount(1) until it receives
* an empty array (this method never returns null!).
*
* @param maxObjectCount
* Specifies how many objects to return with this call.
* @return An array of found objects. The maximum size of this array is
* maxObjectCount, the minimum length is 0. Never returns null.
* @exception TokenException
* A plain TokenException if something during PKCS11 FindObject
* went wrong, a TokenException with a nested TokenException if
* the Exception is raised during object parsing.
*/
public PKCS11Object[] findObjects(int maxObjectCount) throws TokenException {
Vector foundObjects = new Vector<>();
long[] objectHandles;
try {
objectHandles = pkcs11Module.C_FindObjects(sessionHandle, maxObjectCount);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
try {
for (int i = 0; i < objectHandles.length; i++) {
PKCS11Object object = PKCS11Object.getInstance(this, objectHandles[i]);
foundObjects.addElement(object);
}
PKCS11Object[] objectArray = new PKCS11Object[foundObjects.size()];
foundObjects.copyInto(objectArray);
return objectArray;
} catch (TokenException e) {
// encapsulate exception to signal a cause other than C_FindObjects
throw new TokenException(e);
}
}
/**
* Finalizes a find operation. The application must call this method to
* finalize a find operation before attempting to start any other operation.
*
* @exception TokenException
* If finalizing the current find operation was not possible.
*/
public void findObjectsFinal() throws TokenException {
try {
pkcs11Module.C_FindObjectsFinal(sessionHandle);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Initializes a new encryption operation. The application must call this
* method before calling any other encrypt* operation. Before initializing a
* new operation, any currently pending operation must be finalized using
* the appropriate *Final method (e.g. digestFinal()). There are exceptions
* for dual-function operations. This method requires the mechanism to use
* for encryption and the key for this operation. The key must have set its
* encryption flag. For the mechanism the application may use a constant
* defined in the Mechanism class. Notice that the key and the mechanism
* must be compatible; i.e. you cannot use a DES key with the RSA mechanism.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.DES_CBC.
* @param key
* The decryption key to use.
* @exception TokenException
* If initializing this operation failed.
*/
public void encryptInit(Mechanism mechanism, Key key) throws TokenException {
try {
CK_MECHANISM mech = toCkMechanism(mechanism);
pkcs11Module.C_EncryptInit(sessionHandle, mech, key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Encrypts the given data with the key and mechanism given to the
* encryptInit method. This method finalizes the current encryption
* operation; i.e. the application need (and should) not call
* encryptFinal() after this call. For encrypting multiple pieces of data
* use encryptUpdate and encryptFinal.
*
* @param in
* buffer containing the to-be-encrypted data
* @param inOfs
* buffer offset of the to-be-encrypted data
* @param inLen
* length of the to-be-encrypted data
* @param out
* buffer for the encrypted data
* @param outOfs
* buffer offset for the encrypted data
* @param outLen
* buffer size for the encrypted data
* @return the length of encrypted data
* @exception TokenException
* If encrypting failed.
*/
public int encrypt(byte[] in, int inOfs, int inLen,
byte[] out, int outOfs, int outLen) throws TokenException {
Util.requireNonNull("in", in);
Util.requireNonNull("out", out);
try {
if (encrypt0 != null) {
return (int) encrypt0.invoke(pkcs11Module,
sessionHandle, in, inOfs, inLen, out, outOfs, outLen);
} else if (encrypt1 != null) {
return (int) encrypt1.invoke(pkcs11Module,
sessionHandle, 0, in, inOfs, inLen, 0, out, outOfs, outLen);
} else {
throw new IllegalStateException("could not find C_ENCRYPT method");
}
} catch (IllegalAccessException ex) {
throw new TokenException("", ex);
} catch (InvocationTargetException ex) {
Throwable cause = ex.getCause();
if (cause instanceof sun.security.pkcs11.wrapper.PKCS11Exception) {
throw new PKCS11Exception(
((sun.security.pkcs11.wrapper.PKCS11Exception) cause)
.getErrorCode());
} else if (cause instanceof RuntimeException) {
throw (RuntimeException) cause;
} else {
throw new TokenException("Error " + ex.getMessage(), ex);
}
}
}
/**
* This method can be used to encrypt multiple pieces of data; e.g.
* buffer-size pieces when reading the data from a stream. Encrypts the
* given data with the key and mechanism given to the encryptInit method.
* The application must call encryptFinal to get the final result of the
* encryption after feeding in all data using this method.
*
* @param in
* buffer containing the to-be-encrypted data
* @param inOfs
* buffer offset of the to-be-encrypted data
* @param inLen
* length of the to-be-encrypted data
* @param out
* buffer for the encrypted data
* @param outOfs
* buffer offset for the encrypted data
* @param outLen
* buffer size for the encrypted data
* @return the length of encrypted data for this update
* @exception TokenException
* If encrypting the data failed.
*/
public int encryptUpdate(byte[] in, int inOfs, int inLen,
byte[] out, int outOfs, int outLen) throws TokenException {
Util.requireNonNull("in", in);
Util.requireNonNull("out", out);
try {
return pkcs11Module.C_EncryptUpdate(sessionHandle, 0, in, inOfs,
inLen, 0, out, outOfs, outLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method finalizes an encryption operation and returns the final
* result. Use this method, if you fed in the data using encryptUpdate. If
* you used the encrypt(byte[]) method, you need not (and shall not) call
* this method, because encrypt(byte[]) finalizes the encryption itself.
*
* @param out
* buffer for the encrypted data
* @param outOfs
* buffer offset for the encrypted data
* @param outLen
* buffer size for the encrypted data
* @return the length of the last part of the encrypted data
* @exception TokenException
* If calculating the final result failed.
*/
public int encryptFinal(byte[] out, int outOfs, int outLen)
throws TokenException {
Util.requireNonNull("out", out);
try {
return pkcs11Module.C_EncryptFinal(sessionHandle, 0,
out, outOfs, outLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Initializes a new decryption operation. The application must call this
* method before calling any other decrypt* operation. Before initializing a
* new operation, any currently pending operation must be finalized using
* the appropriate *Final method (e.g. digestFinal()). There are exceptions
* for dual-function operations. This method requires the mechanism to use
* for decryption and the key for this operation. The key must have set its
* decryption flag. For the mechanism the application may use a constant
* defined in the Mechanism class. Notice that the key and the mechanism
* must be compatible; i.e. you cannot use a DES key with the RSA mechanism.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.DES_CBC.
* @param key
* The decryption key to use.
* @exception TokenException
* If initializing this operation failed.
*/
public void decryptInit(Mechanism mechanism, Key key) throws TokenException {
try {
pkcs11Module.C_DecryptInit(sessionHandle, toCkMechanism(mechanism),
key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Decrypts the given data with the key and mechanism given to the
* decryptInit method. This method finalizes the current decryption
* operation; i.e. the application need (and should) not call decryptFinal()
* after this call. For decrypting multiple pieces of data use decryptUpdate
* and decryptFinal.
*
* @param in
* buffer containing the to-be-decrypted data
* @param inOfs
* buffer offset of the to-be-decrypted data
* @param inLen
* length of the to-be-decrypted data
* @param out
* buffer for the decrypted data
* @param outOfs
* buffer offset for the decrypted data
* @param outLen
* buffer size for the decrypted data
* @return the length of decrypted data
* @exception TokenException
* If decrypting failed.
*/
public int decrypt(byte[] in, int inOfs, int inLen,
byte[] out, int outOfs, int outLen) throws TokenException {
Util.requireNonNull("in", in);
Util.requireNonNull("out", out);
try {
if (decrypt0 != null) {
return (int) decrypt0.invoke(pkcs11Module,
sessionHandle, in, inOfs, inLen, out, outOfs, outLen);
} else if (decrypt1 != null) {
return (int) decrypt1.invoke(pkcs11Module,
sessionHandle, 0, in, inOfs, inLen, 0, out, outOfs, outLen);
} else {
throw new IllegalStateException("could not find C_DECRYPT method");
}
} catch (IllegalAccessException ex) {
throw new TokenException("", ex);
} catch (InvocationTargetException ex) {
Throwable cause = ex.getCause();
if (cause instanceof sun.security.pkcs11.wrapper.PKCS11Exception) {
throw new PKCS11Exception(
((sun.security.pkcs11.wrapper.PKCS11Exception) cause)
.getErrorCode());
} else if (cause instanceof RuntimeException) {
throw (RuntimeException) cause;
} else {
throw new TokenException("Error " + ex.getMessage(), ex);
}
}
}
/**
* This method can be used to decrypt multiple pieces of data; e.g.
* buffer-size pieces when reading the data from a stream. Decrypts the
* given data with the key and mechanism given to the decryptInit method.
* The application must call decryptFinal to get the final result of the
* encryption after feeding in all data using this method.
*
* @param in
* buffer containing the to-be-decrypted data
* @param inOfs
* buffer offset of the to-be-decrypted data
* @param inLen
* length of the to-be-decrypted data
* @param out
* buffer for the decrypted data
* @param outOfs
* buffer offset for the decrypted data
* @param outLen
* buffer size for the decrypted data
* @return the length of decrypted data for this update
* @exception TokenException
* If decrypting the data failed.
*/
public int decryptUpdate(byte[] in, int inOfs, int inLen,
byte[] out, int outOfs, int outLen) throws TokenException {
Util.requireNonNull("in", in);
Util.requireNonNull("out", out);
try {
return pkcs11Module.C_DecryptUpdate(sessionHandle, 0, in, inOfs,
inLen, 0, out, outOfs, outLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method finalizes a decryption operation and returns the final
* result. Use this method, if you fed in the data using decryptUpdate. If
* you used the decrypt(byte[]) method, you need not (and shall not) call
* this method, because decrypt(byte[]) finalizes the decryption itself.
*
* @param out
* buffer for the decrypted data
* @param outOfs
* buffer offset for the decrypted data
* @param outLen
* buffer size for the decrypted data
* @return the length of this last part of decrypted data
* @exception TokenException
* If calculating the final result failed.
*/
public int decryptFinal(byte[] out, int outOfs, int outLen)
throws TokenException {
Util.requireNonNull("out", out);
try {
return pkcs11Module.C_DecryptFinal(sessionHandle, 0,
out, outOfs, outLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Initializes a new digesting operation. The application must call this
* method before calling any other digest* operation. Before initializing a
* new operation, any currently pending operation must be finalized using
* the appropriate *Final method (e.g. digestFinal()). There are exceptions
* for dual-function operations. This method requires the mechanism to use
* for digesting for this operation. For the mechanism the application may
* use a constant defined in the Mechanism class.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.SHA_1.
* @exception TokenException
* If initializing this operation failed.
*/
public void digestInit(Mechanism mechanism) throws TokenException {
try {
pkcs11Module.C_DigestInit(sessionHandle, toCkMechanism(mechanism));
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Digests the given data with the mechanism given to the digestInit method.
* This method finalizes the current digesting operation; i.e. the
* application need (and should) not call digestFinal() after this call. For
* digesting multiple pieces of data use digestUpdate and digestFinal.
*
* @param in
* buffer containing the to-be-digested data
* @param inOfs
* buffer offset of the to-be-digested data
* @param inLen
* length of the to-be-digested data
* @param digest
* buffer for the digested data
* @param digestOfs
* buffer offset for the digested data
* @param digestLen
* buffer size for the digested data
* @return the length of digested data for this update
* @exception TokenException
* If digesting the data failed.
*/
public int digest(byte[] in, int inOfs, int inLen, byte[] digest,
int digestOfs, int digestLen) throws TokenException {
digestUpdate(in, inOfs, inLen);
return digestFinal(digest, digestOfs, digestLen);
}
/**
* This method digests data in a single part.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.SHA_1.
* @param in
* buffer containing the to-be-digested data
* @param inOfs
* buffer offset of the to-be-digested data
* @param inLen
* length of the to-be-digested data
* @param digest
* buffer for the digested data
* @param digestOfs
* buffer offset for the digested data
* @param digestLen
* buffer size for the digested data
* @return the length of digested data for this update
* @throws TokenException
* If digesting the data failed.
*/
public int digestSingle(Mechanism mechanism, byte[] in, int inOfs,
int inLen, byte[] digest, int digestOfs, int digestLen)
throws TokenException {
Util.requireNonNull("in", in);
Util.requireNonNull("digest", digest);
try {
return pkcs11Module.C_DigestSingle(sessionHandle,
toCkMechanism(mechanism),
in, inOfs, inLen, digest, digestOfs, digestLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method can be used to digest multiple pieces of data; e.g.
* buffer-size pieces when reading the data from a stream. Digests the given
* data with the mechanism given to the digestInit method. The application
* must call digestFinal to get the final result of the digesting after
* feeding in all data using this method.
*
* @param part
* buffer containing the to-be-digested data
* @param partOfs
* buffer offset of the to-be-digested data
* @param partLen
* length of the to-be-digested data
* @exception TokenException
* If digesting the data failed.
*/
public void digestUpdate(byte[] part, int partOfs, int partLen)
throws TokenException {
Util.requireNonNull("part", part);
try {
pkcs11Module.C_DigestUpdate(sessionHandle, 0, part, partOfs, partLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method is similar to digestUpdate and can be combined with it during
* one digesting operation. This method digests the value of the given
* secret key.
*
* @param key
* The key to digest the value of.
* @exception TokenException
* If digesting the key failed.
*/
public void digestKey(SecretKey key) throws TokenException {
try {
pkcs11Module.C_DigestKey(sessionHandle, key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method finalizes a digesting operation and returns the final result.
* Use this method, if you fed in the data using digestUpdate and/or
* digestKey. If you used the digest(byte[]) method, you need not (and shall
* not) call this method, because digest(byte[]) finalizes the digesting
* itself.
*
* @param digest
* buffer for the message digest
* @param digestOfs
* buffer offset for the message digest
* @param digestLen
* buffer size for the message digest
* @return the length of message digest
* @exception TokenException
* If calculating the final message digest failed.
*/
public int digestFinal(byte[] digest, int digestOfs, int digestLen)
throws TokenException {
Util.requireNonNull("digest", digest);
try {
return pkcs11Module.C_DigestFinal(sessionHandle,
digest, digestOfs, digestLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Initializes a new signing operation. Use it for signatures and MACs. The
* application must call this method before calling any other sign*
* operation. Before initializing a new operation, any currently pending
* operation must be finalized using the appropriate *Final method
* (e.g. digestFinal()). There are exceptions for dual-function operations.
* This method requires the mechanism to use for signing and the key for
* this operation. The key must have set its sign flag. For the mechanism
* the application may use a constant defined in the Mechanism class. Notice
* that the key and the mechanism must be compatible; i.e. you cannot use a
* DES key with the RSA mechanism.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.RSA_PKCS.
* @param key
* The signing key to use.
* @exception TokenException
* If initializing this operation failed.
*/
public void signInit(Mechanism mechanism, Key key) throws TokenException {
try {
pkcs11Module.C_SignInit(sessionHandle, toCkMechanism(mechanism),
key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Signs the given data with the key and mechanism given to the signInit
* method. This method finalizes the current signing operation; i.e. the
* application need (and should) not call signFinal() after this call. For
* signing multiple pieces of data use signUpdate and signFinal.
*
* @param data
* The data to sign.
* @return The signed data.
* @exception TokenException
* If signing the data failed.
*/
public byte[] sign(byte[] data) throws TokenException {
Util.requireNonNull("data", data);
try {
return pkcs11Module.C_Sign(sessionHandle, data);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method can be used to sign multiple pieces of data; e.g. buffer-size
* pieces when reading the data from a stream. Signs the given data with the
* mechanism given to the signInit method. The application must call
* signFinal to get the final result of the signing after feeding in all
* data using this method.
*
* @param in
* buffer containing the to-be-signed data
* @param inOfs
* buffer offset of the to-be-signed data
* @param inLen
* length of the to-be-signed data
* @exception TokenException
* If signing the data failed.
*/
public void signUpdate(byte[] in, int inOfs, int inLen)
throws TokenException {
Util.requireNonNull("in", in);
try {
pkcs11Module.C_SignUpdate(sessionHandle, 0, in, inOfs, inLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method finalizes a signing operation and returns the final result.
* Use this method, if you fed in the data using signUpdate. If you used the
* sign(byte[]) method, you need not (and shall not) call this method,
* because sign(byte[]) finalizes the signing operation itself.
*
* @param expectedLen
* expected length of the signature value.
* @return The final result of the signing operation; i.e. the signature
* value.
* @exception TokenException
* If calculating the final signature value failed.
*/
public byte[] signFinal(int expectedLen) throws TokenException {
try {
return pkcs11Module.C_SignFinal(sessionHandle, expectedLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Initializes a new signing operation for signing with recovery. The
* application must call this method before calling signRecover. Before
* initializing a new operation, any currently pending operation must be
* finalized using the appropriate *Final method (e.g. digestFinal()). There
* are exceptions for dual-function operations. This method requires the
* mechanism to use for signing and the key for this operation. The key must
* have set its sign-recover flag. For the mechanism the application may use
* a constant defined in the Mechanism class. Notice that the key and the
* mechanism must be compatible; i.e. you cannot use a DES key with the RSA
* mechanism.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.RSA_9796.
* @param key
* The signing key to use.
* @exception TokenException
* If initializing this operation failed.
*/
public void signRecoverInit(Mechanism mechanism, Key key)
throws TokenException {
try {
pkcs11Module.C_SignRecoverInit(sessionHandle,
toCkMechanism(mechanism), key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Signs the given data with the key and mechanism given to the
* signRecoverInit method. This method finalizes the current sign-recover
* operation; there is no equivalent method to signUpdate for signing with
* recovery.
*
* @param in
* buffer containing the to-be-signed data
* @param inOfs
* buffer offset of the to-be-signed data
* @param inLen
* length of the to-be-signed data
* @param out
* buffer for the signed data
* @param outOfs
* buffer offset for the signed data
* @param outLen
* buffer size for the signed data
* @return the length of signed data
* @exception TokenException
* If signing the data failed.
*/
public int signRecover(byte[] in, int inOfs,
int inLen, byte[] out, int outOfs, int outLen) throws TokenException {
Util.requireNonNull("in", in);
Util.requireNonNull("out", out);
try {
return pkcs11Module.C_SignRecover(sessionHandle, in, inOfs, inLen,
out, outOfs, outLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Initializes a new verification operation. You can use it for verifying
* signatures and MACs. The application must call this method before calling
* any other verify* operation. Before initializing a new operation, any
* currently pending operation must be finalized using the appropriate
* *Final method (e.g. digestFinal()). There are exceptions for
* dual-function operations. This method requires the mechanism to use for
* verification and the key for this operation. The key must have set its
* verify flag. For the mechanism the application may use a constant defined
* in the Mechanism class. Notice that the key and the mechanism must be
* compatible; i.e. you cannot use a DES key with the RSA mechanism.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.RSA_PKCS.
* @param key
* The verification key to use.
* @exception TokenException
* If initializing this operation failed.
*/
public void verifyInit(Mechanism mechanism, Key key) throws TokenException {
try {
pkcs11Module.C_VerifyInit(sessionHandle, toCkMechanism(mechanism),
key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Verifies the given signature against the given data with the key and
* mechanism given to the verifyInit method. This method finalizes the
* current verification operation; i.e. the application need (and should)
* not call verifyFinal() after this call. For verifying with multiple
* pieces of data use verifyUpdate and verifyFinal. This method throws an
* exception, if the verification of the signature fails.
*
* @param data
* The data that was signed.
* @param signature
* The signature or MAC to verify.
* @exception TokenException
* If verifying the signature fails. This is also the case, if
* the signature is forged.
*/
public void verify(byte[] data, byte[] signature) throws TokenException {
Util.requireNonNull("signature", signature);
try {
pkcs11Module.C_Verify(sessionHandle, data, signature);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method can be used to verify a signature with multiple pieces of
* data; e.g. buffer-size pieces when reading the data from a stream. To
* verify the signature or MAC call verifyFinal after feeding in all data
* using this method.
*
* @param in
* buffer containing the to-be-verified data
* @param inOfs
* buffer offset of the to-be-verified data
* @param inLen
* length of the to-be-verified data
* @exception TokenException
* If verifying (e.g. digesting) the data failed.
*/
public void verifyUpdate(byte[] in, int inOfs, int inLen)
throws TokenException {
Util.requireNonNull("in", in);
try {
pkcs11Module.C_VerifyUpdate(sessionHandle, 0, in, inOfs, inLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* This method finalizes a verification operation. Use this method, if you
* fed in the data using verifyUpdate. If you used the verify(byte[])
* method, you need not (and shall not) call this method, because
* verify(byte[]) finalizes the verification operation itself. If this
* method verified the signature successfully, it returns normally. If the
* verification of the signature fails, e.g. if the signature was forged or
* the data was modified, this method throws an exception.
*
* @param signature
* The signature value.
* @exception TokenException
* If verifying the signature fails. This is also the case, if
* the signature is forged.
*/
public void verifyFinal(byte[] signature) throws TokenException {
Util.requireNonNull("signature", signature);
try {
pkcs11Module.C_VerifyFinal(sessionHandle, signature);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Initializes a new verification operation for verification with data
* recovery. The application must call this method before calling
* verifyRecover. Before initializing a new operation, any currently pending
* operation must be finalized using the appropriate *Final method (e.g.
* digestFinal()). This method requires the mechanism to use for
* verification and the key for this operation. The key must have set its
* verify-recover flag. For the mechanism the application may use a constant
* defined in the Mechanism class. Notice that the key and the mechanism
* must be compatible; i.e. you cannot use a DES key with the RSA mechanism.
*
* @param mechanism
* The mechanism to use; e.g. Mechanism.RSA_9796.
* @param key
* The verification key to use.
* @exception TokenException
* If initializing this operation failed.
*/
public void verifyRecoverInit(Mechanism mechanism, Key key)
throws TokenException {
try {
pkcs11Module.C_VerifyRecoverInit(sessionHandle,
toCkMechanism(mechanism), key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Signs the given data with the key and mechanism given to the
* signRecoverInit method. This method finalizes the current sign-recover
* operation; there is no equivalent method to signUpdate for signing with
* recovery.
*
* @param in
* buffer containing the to-be-verified data
* @param inOfs
* buffer offset of the to-be-verified data
* @param inLen
* length of the to-be-verified data
* @param out
* buffer for the verified data
* @param outOfs
* buffer offset for the verified data
* @param outLen
* buffer size for the verified data
* @return the length of verified data
* @exception TokenException
* If signing the data failed.
*/
public int verifyRecover(byte[] in, int inOfs,
int inLen, byte[] out, int outOfs, int outLen) throws TokenException {
Util.requireNonNull("in", in);
Util.requireNonNull("out", out);
try {
return pkcs11Module.C_VerifyRecover(sessionHandle,
in, inOfs, inLen, out, outOfs, outLen);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Dual-function. Continues a multipart dual digest and encryption
* operation. This method call can also be combined with calls to
* digestUpdate, digestKey and encryptUpdate. Call digestFinal and
* encryptFinal to get the final results.
*
* @param part
* The piece of data to digest and encrypt.
* @return The intermediate result of the encryption.
* @exception TokenException
* If digesting or encrypting the data failed.
*/
/*
public byte[] digestEncryptedUpdate(byte[] part)
throws TokenException {
return pkcs11Module.C_DigestEncryptUpdate(sessionHandle, part);
}
*/
/**
* Dual-function. Continues a multipart dual decrypt and digest operation.
* This method call can also be combined with calls to digestUpdate,
* digestKey and decryptUpdate. It is the recovered plaintext that gets
* digested in this method call, not the given encryptedPart. Call
* digestFinal and decryptFinal to get the final results.
*
* @param part
* The piece of data to decrypt and digest.
* @return The intermediate result of the decryption; the decrypted data.
* @exception TokenException
* If decrypting or digesting the data failed.
*/
/*
public byte[] decryptDigestUpdate(byte[] part)
throws TokenException {
return pkcs11Module.C_DecryptDigestUpdate(sessionHandle, part);
}
*/
/**
* Dual-function. Continues a multipart dual sign and encrypt operation.
* Calls to this method can also be combined with calls to signUpdate and
* encryptUpdate. Call signFinal and encryptFinal to get the final results.
*
* @param part
* The piece of data to sign and encrypt.
* @return The intermediate result of the encryption; the encrypted data.
* @exception TokenException
* If signing or encrypting the data failed.
*/
/*
public byte[] signEncryptUpdate(byte[] part)
throws TokenException {
return pkcs11Module.C_SignEncryptUpdate(sessionHandle, part);
}
*/
/**
* Dual-function. Continues a multipart dual decrypt and verify operation.
* This method call can also be combined with calls to decryptUpdate and
* verifyUpdate. It is the recovered plaintext that gets verified in this
* method call, not the given encryptedPart. Call decryptFinal and
* verifyFinal to get the final results.
*
* @param encryptedPart
* The piece of data to decrypt and verify.
* @return The intermediate result of the decryption; the decrypted data.
* @exception TokenException
* If decrypting or verifying the data failed.
*/
/*
public byte[] decryptVerifyUpdate(byte[] encryptedPart)
throws TokenException {
return pkcs11Module.C_DecryptVerifyUpdate(sessionHandle,
encryptedPart);
}
*/
/**
* Generate a new secret key or a set of domain parameters. It uses the set
* attributes of the template for setting the attributes of the new key
* object. As mechanism the application can use a constant of the Mechanism
* class.
*
* @param mechanism
* The mechanism to generate a key for; e.g. Mechanism.DES to
* generate a DES key.
* @param template
* The template for the new key or domain parameters; e.g. a
* DESSecretKey object which has set certain attributes.
* @return The newly generated secret key or domain parameters.
* @exception TokenException
* If generating a new secret key or domain parameters failed.
*/
public PKCS11Object generateKey(Mechanism mechanism, PKCS11Object template)
throws TokenException {
CK_ATTRIBUTE[] ckAttributes = PKCS11Object.getSetAttributes(template);
long objectHandle;
try {
objectHandle = pkcs11Module.C_GenerateKey(sessionHandle,
toCkMechanism(mechanism), ckAttributes);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
return PKCS11Object.getInstance(this, objectHandle);
}
/**
* Generate a new public key - private key key-pair and use the set
* attributes of the template objects for setting the attributes of the new
* public key and private key objects. As mechanism the application can use
* a constant of the Mechanism class.
*
* @param mechanism
* The mechanism to generate a key for; e.g. Mechanism.RSA to
* generate a new RSA key-pair.
* @param publicKeyTemplate
* The template for the new public key part; e.g. a RSAPublicKey
* object which has set certain attributes (e.g. public exponent
* and verify).
* @param privateKeyTemplate
* The template for the new private key part; e.g. a RSAPrivateKey
* object which has set certain attributes (e.g. sign and decrypt).
* @return The newly generated key-pair.
* @exception TokenException
* If generating a new key-pair failed.
*/
public KeyPair generateKeyPair(Mechanism mechanism,
PKCS11Object publicKeyTemplate, PKCS11Object privateKeyTemplate)
throws TokenException {
CK_ATTRIBUTE[] ckPublicKeyAttributes =
PKCS11Object.getSetAttributes(publicKeyTemplate);
CK_ATTRIBUTE[] ckPrivateKeyAttributes =
PKCS11Object.getSetAttributes(privateKeyTemplate);
long[] objectHandles;
try {
objectHandles = pkcs11Module.C_GenerateKeyPair(sessionHandle,
toCkMechanism(mechanism), ckPublicKeyAttributes,
ckPrivateKeyAttributes);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
PublicKey publicKey =
(PublicKey) PKCS11Object.getInstance(this, objectHandles[0]);
PrivateKey privateKey =
(PrivateKey) PKCS11Object.getInstance(this, objectHandles[1]);
return new KeyPair(publicKey, privateKey);
}
/**
* Wraps (encrypts) the given key with the wrapping key using the given
* mechanism.
*
* @param mechanism
* The mechanism to use for wrapping the key.
* @param wrappingKey
* The key to use for wrapping (encrypting).
* @param key
* The key to wrap (encrypt).
* @return The wrapped key as byte array.
* @exception TokenException
* If wrapping the key failed.
*/
public byte[] wrapKey(Mechanism mechanism, Key wrappingKey, Key key)
throws TokenException {
try {
return pkcs11Module.C_WrapKey(sessionHandle, toCkMechanism(mechanism),
wrappingKey.getObjectHandle(), key.getObjectHandle());
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Unwraps (decrypts) the given encrypted key with the unwrapping key using
* the given mechanism. The application can also pass a template key to set
* certain attributes of the unwrapped key. This creates a key object after
* unwrapping the key and returns an object representing this key.
*
* @param mechanism
* The mechanism to use for unwrapping the key.
* @param unwrappingKey
* The key to use for unwrapping (decrypting).
* @param wrappedKey
* The encrypted key to unwrap (decrypt).
* @param keyTemplate
* The template for creating the new key object.
* @return A key object representing the newly created key object.
* @exception TokenException
* If unwrapping the key or creating a new key object failed.
*/
public Key unwrapKey(Mechanism mechanism, Key unwrappingKey,
byte[] wrappedKey, PKCS11Object keyTemplate)
throws TokenException {
Util.requireNonNull("wrappedKey", wrappedKey);
CK_ATTRIBUTE[] ckAttributes = PKCS11Object.getSetAttributes(keyTemplate);
long objectHandle;
try {
objectHandle = pkcs11Module.C_UnwrapKey(sessionHandle,
toCkMechanism(mechanism), unwrappingKey.getObjectHandle(),
wrappedKey, ckAttributes);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
return (Key) PKCS11Object.getInstance(this, objectHandle);
}
/**
* Derives a new key from a specified base key using the given mechanism.
* After deriving a new key from the base key, a new key object is created
* and a representation of it is returned. The application can provide a
* template key to set certain attributes of the new key object.
*
* @param mechanism
* The mechanism to use for deriving the new key from the base key.
* @param baseKey
* The key to use as base for derivation.
* @param template
* The template for creating the new key object.
* @return A key object representing the newly derived (created) key object
* or null, if the used mechanism uses other means to return its
* values; e.g. the CKM_SSL3_KEY_AND_MAC_DERIVE mechanism.
* @exception TokenException
* If deriving the key or creating a new key object failed.
*/
public Key deriveKey(Mechanism mechanism, Key baseKey, Key template)
throws TokenException {
CK_MECHANISM ckMechanism = toCkMechanism(mechanism);
Parameters params = mechanism.getParameters();
CK_ATTRIBUTE[] ckAttributes = PKCS11Object.getSetAttributes(template);
long objectHandle;
try {
objectHandle = pkcs11Module.C_DeriveKey(sessionHandle,
toCkMechanism(mechanism), baseKey.getObjectHandle(), ckAttributes);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
/*
* for certain mechanisms we must copy back the returned values to the
* parameters object of the given mechanism
*/
if ((ckMechanism.mechanism
== PKCS11Constants.CKM_SSL3_MASTER_KEY_DERIVE
|| ckMechanism.mechanism
== PKCS11Constants.CKM_TLS_MASTER_KEY_DERIVE)
&& (params instanceof SSL3MasterKeyDeriveParameters)) {
/*
* The SSL3MasterKeyDeriveParameters object need special handling
* due to their deeper nesting of their data structure, which needs
* to be copied back to get all the results.
*/
// set the returned client version
VersionParameters version =
((SSL3MasterKeyDeriveParameters) params).getVersion();
version.setPKCS11ParamsObject(
((CK_SSL3_MASTER_KEY_DERIVE_PARAMS)
(ckMechanism.pParameter)).pVersion);
return (Key) PKCS11Object.getInstance(this, objectHandle);
} else if ((ckMechanism.mechanism
== PKCS11Constants.CKM_TLS12_MASTER_KEY_DERIVE)
&& (params instanceof TLS12MasterKeyDeriveParameters)) {
// set the returned client version
VersionParameters version =
((TLS12MasterKeyDeriveParameters) params).getVersion();
CK_VERSION ckVersion =
TLS12MasterKeyDeriveParameters.getPVersion(ckMechanism.pParameter);
version.setPKCS11ParamsObject(ckVersion);
return (Key) PKCS11Object.getInstance(this, objectHandle);
} else if ((ckMechanism.mechanism
== PKCS11Constants.CKM_SSL3_KEY_AND_MAC_DERIVE
|| ckMechanism.mechanism
== PKCS11Constants.CKM_TLS_KEY_AND_MAC_DERIVE)
&& (params instanceof SSL3KeyMaterialParameters)) {
/*
* The SSL3KeyMaterialParameters object need special handling due to
* their deeper nesting of their data structure, which needs to be
* copied back to get all the results.
*/
// set the returned secret keys and IVs
((SSL3KeyMaterialParameters) params).getReturnedKeyMaterial()
.setPKCS11ParamsObject(
((CK_SSL3_KEY_MAT_PARAMS) ckMechanism.pParameter)
.pReturnedKeyMaterial,
this);
/*
* this mechanism returns its keys and values through the parameters
* object of the mechanism, but it does not return a key
*/
return null;
} else if ((ckMechanism.mechanism
== PKCS11Constants.CKM_TLS12_KEY_AND_MAC_DERIVE)
&& (params instanceof TLS12KeyMaterialParameters)) {
// set the returned secret keys and IVs
CK_SSL3_KEY_MAT_OUT pReturnedMaterial =
TLS12KeyMaterialParameters.getPReturnedKeyMaterial(
ckMechanism.pParameter);
((TLS12KeyMaterialParameters) params).getReturnedKeyMaterial()
.setPKCS11ParamsObject(pReturnedMaterial, this);
/*
* this mechanism returns its keys and values through the parameters
* object of the mechanism, but it does not return a key
*/
return null;
} else {
return (Key) PKCS11Object.getInstance(this, objectHandle);
}
}
/**
* Mixes additional seeding material into the random number generator.
*
* @param seed
* The seed bytes to mix in.
* @exception TokenException
* If mixing in the seed failed.
*/
public void seedRandom(byte[] seed) throws TokenException {
try {
pkcs11Module.C_SeedRandom(sessionHandle, seed);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
}
}
/**
* Generates a certain number of random bytes.
*
* @param numberOfBytesToGenerate
* The number of random bytes to generate.
* @return An array of random bytes with length numberOfBytesToGenerate.
* @exception TokenException
* If generating random bytes failed.
*/
public byte[] generateRandom(int numberOfBytesToGenerate)
throws TokenException {
byte[] randomBytesBuffer = new byte[numberOfBytesToGenerate];
try {
pkcs11Module.C_GenerateRandom(sessionHandle, randomBytesBuffer);
} catch (sun.security.pkcs11.wrapper.PKCS11Exception ex) {
throw new PKCS11Exception(ex);
} // fill the buffer with random bytes
return randomBytesBuffer;
}
/**
* Legacy function that will normally throw an PKCS11Exception with the
* error-code PKCS11Constants.CKR_FUNCTION_NOT_PARALLEL.
*
* @exception TokenException
* Throws always an PKCS11Excption.
*/
/*
public void getFunctionStatus()
throws TokenException {
pkcs11Module.C_GetFunctionStatus(sessionHandle);
}*/
/**
* Legacy function that will normally throw an PKCS11Exception with the
* error-code PKCS11Constants.CKR_FUNCTION_NOT_PARALLEL.
*
* @exception TokenException
* Throws always an PKCS11Excption.
*/
/*
public void cancelFunction()
throws TokenException {
pkcs11Module.C_CancelFunction(sessionHandle);
}*/
/**
* Returns the string representation of this object.
*
* @return the string representation of this object
*/
@Override
public String toString() {
return Util.concatObjectsCap(100,
"Session Handle: 0x", Long.toHexString(sessionHandle),
"\nToken: ", token);
}
private static CK_MECHANISM toCkMechanism(Mechanism mechanism) {
long code = mechanism.getMechanismCode();
Parameters params = mechanism.getParameters();
if (params == null) {
return new CK_MECHANISM(code);
} else if (params instanceof AesCtrParameters) {
return new CK_MECHANISM(code,
((AesCtrParameters) params).getPKCS11ParamsObject());
} else if (params instanceof DHPkcsDeriveParameters) {
return new CK_MECHANISM(code,
((DHPkcsDeriveParameters) params).getPKCS11ParamsObject());
} else if (params instanceof EcDH1KeyDerivationParameters) {
return new CK_MECHANISM(code,
((EcDH1KeyDerivationParameters) params).getPKCS11ParamsObject());
} else if (params instanceof EcDH2KeyDerivationParameters) {
// return new CK_MECHANISM(code,
// ((EcDH2KeyDerivationParameters) params).getPKCS11ParamsObject());
} else if (params instanceof ExtractParameters) {
return new CK_MECHANISM(code,
((ExtractParameters) params).getPKCS11ParamsObject());
} else if (params instanceof InitializationVectorParameters) {
return new CK_MECHANISM(code,
((InitializationVectorParameters) params).getPKCS11ParamsObject());
} else if (params instanceof MacGeneralParameters) {
return new CK_MECHANISM(code,
((MacGeneralParameters) params).getPKCS11ParamsObject());
} else if (params instanceof ObjectHandleParameters) {
return new CK_MECHANISM(code,
((ObjectHandleParameters) params).getPKCS11ParamsObject());
} else if (params instanceof OpaqueParameters) {
return new CK_MECHANISM(code,
((OpaqueParameters) params).getPKCS11ParamsObject());
} else if (params instanceof PBEParameters) {
// return new CK_MECHANISM(code,
// ((PBEParameters) params).getPKCS11ParamsObject());
} else if (params instanceof PKCS5PBKD2Parameters) {
// return new CK_MECHANISM(code,
// ((PKCS5PBKD2Parameters) params).getPKCS11ParamsObject());
} else if (params instanceof RSAPkcsOaepParameters) {
// return new CK_MECHANISM(code,
// ((RSAPkcsOaepParameters) params).getPKCS11ParamsObject());
} else if (params instanceof RSAPkcsPssParameters) {
CK_MECHANISM mech = new CK_MECHANISM(code);
CK_RSA_PKCS_PSS_PARAMS pParams =
((RSAPkcsPssParameters) params).getPKCS11ParamsObject();
try {
if (field_CK_MECHANISM_pParameter != null) {
field_CK_MECHANISM_pParameter.set(mech, pParams);
} else if (method_CK_MECHANISM_setParameter != null) {
method_CK_MECHANISM_setParameter.invoke(mech, pParams);
} else {
throw new IllegalStateException(
"could not construct CK_MECHANISM for RSAPkcsPssParams");
}
} catch (IllegalAccessException | InvocationTargetException ex) {
throw new IllegalStateException(
"could not construct CK_MECHANISM for RSAPkcsPssParams", ex);
}
return mech;
} else if (params instanceof SSL3KeyMaterialParameters) {
return new CK_MECHANISM(code,
((SSL3KeyMaterialParameters) params).getPKCS11ParamsObject());
} else if (params instanceof SSL3KeyMaterialParameters) {
return new CK_MECHANISM(code,
((SSL3KeyMaterialParameters) params).getPKCS11ParamsObject());
} else if (params instanceof SSL3MasterKeyDeriveParameters) {
return new CK_MECHANISM(code,
((SSL3MasterKeyDeriveParameters) params).getPKCS11ParamsObject());
} else if (params instanceof SSL3RandomDataParameters) {
// return new CK_MECHANISM(code,
// ((SSL3RandomDataParameters) params).getPKCS11ParamsObject());
} else if (params instanceof TLSPRFParameters) {
return new CK_MECHANISM(code,
((TLSPRFParameters) params).getPKCS11ParamsObject());
} else if (params instanceof VersionParameters) {
return new CK_MECHANISM(code,
((VersionParameters) params).getPKCS11ParamsObject());
} else if (params instanceof X942DH1KeyDerivationParameters) {
// return new CK_MECHANISM(code,
// ((X942DH1KeyDerivationParameters) params).getPKCS11ParamsObject());
} else if (params instanceof X942DH2KeyDerivationParameters) {
// return new CK_MECHANISM(code,
// ((X942DH2KeyDerivationParameters) params).getPKCS11ParamsObject());
} else {
Constructor constructor;
if (params instanceof CCMParameters) {
constructor = constructor_CK_MECHANISM_CCM;
} else if (params instanceof GCMParameters) {
constructor = constructor_CK_MECHANISM_GCM;
} else if (params instanceof TLS12KeyMaterialParameters) {
constructor = constructor_CK_MECHANISM_TLS12KeyMat;
} else if (params instanceof TLS12MasterKeyDeriveParameters) {
constructor = constructor_CK_MECHANISM_TLS12MasterKeyDerive;
} else if (params instanceof TLSMacParameters) {
constructor = constructor_CK_MECHANISM_TLSMac;
} else {
constructor = null;
}
if (constructor == null) {
throw new IllegalArgumentException("could not find constructor");
}
try {
return (CK_MECHANISM) constructor.newInstance(
code, params.getPKCS11ParamsObject());
} catch (InstantiationException | IllegalAccessException
| IllegalArgumentException | InvocationTargetException ex) {
throw new IllegalArgumentException(
"could not construct CK_MECHANISM", ex);
}
}
throw new IllegalArgumentException(
"Unsupported Parameters " + params.getClass().getName());
}
}